dibutyl heptanedioate

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

dibutyl heptanedioate
Links:📏 NIST
CAS RN:[51238-94-9]
Formula:C15H28O4; 272.38 g/mol
InChiKey:IQYKLRJIMOPPKB-UHFFFAOYSA-N
SMILES:CCCCOC(=O)CCCCCC(=O)OCCCC
Molecular structure of dibutyl heptanedioate

Isomers

dibutyl heptanedioate
Molecular structure of dibutyl heptanedioate
diethyl 2,2-dibutylpropanedioate
Molecular structure of diethyl 2,2-dibutylpropanedioate
dimethyl tridecanedioate
Molecular structure of dimethyl tridecanedioate
2-(2-{[2-ethylhexyl]oxy}ethoxy)ethyl prop-2-enoate
Molecular structure of 2-(2-{[2-ethylhexyl]oxy}ethoxy)ethyl prop-2-enoate
pentadecanedioic acid
Molecular structure of pentadecanedioic acid
  ::